C28H36N2O8 — CID 10554169
tetraethyl 3-(1,3-diethylbenzimidazol-2-ylidene)penta-1,4-diene-1,1,5,5-tetracarboxylate (PubChem CID 10554169) has the molecular formula C28H36N2O8 and a molecular weight of 528.60 g/mol. Its IUPAC name is tetraethyl 3-(1,3-diethylbenzimidazol-2-ylidene)penta-1,4-diene-1,1,5,5-tetracarboxylate.
| Compound Name | tetraethyl 3-(1,3-diethylbenzimidazol-2-ylidene)penta-1,4-diene-1,1,5,5-tetracarboxylate |
|---|---|
| PubChem CID | 10554169 |
| Molecular Formula | C28H36N2O8 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | tetraethyl 3-(1,3-diethylbenzimidazol-2-ylidene)penta-1,4-diene-1,1,5,5-tetracarboxylate |
| SMILES | CCOC(=O)C(=CC(C=C(C(=O)OCC)C(=O)OCC)=C1N(CC)c2ccccc2N1CC)C(=O)OCC |
| InChI | InChI=1S/C28H36N2O8/c1-7-29-22-15-13-14-16-23(22)30(8-2)24(29)19(17-20(25(31)35-9-3)26(32)36-10-4)18-21(27(33)37-11-5)28(34)38-12-6/h13-18H,7-12H2,1-6H3 |
| InChIKey | BPGZEIGQURYTJA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|