C18H18N2O3 — CID 54249326
ethyl 6-(3-ethyl-1,3-benzoxazol-2-ylidene)-2-isocyanohexa-2,4-dienoate (PubChem CID 54249326) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is ethyl 6-(3-ethyl-1,3-benzoxazol-2-ylidene)-2-isocyanohexa-2,4-dienoate.
| Compound Name | ethyl 6-(3-ethyl-1,3-benzoxazol-2-ylidene)-2-isocyanohexa-2,4-dienoate |
|---|---|
| PubChem CID | 54249326 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | ethyl 6-(3-ethyl-1,3-benzoxazol-2-ylidene)-2-isocyanohexa-2,4-dienoate |
| SMILES | [C-]#[N+]C(=CC=CC=C1Oc2ccccc2N1CC)C(=O)OCC |
| InChI | InChI=1S/C18H18N2O3/c1-4-20-15-11-7-8-12-16(15)23-17(20)13-9-6-10-14(19-3)18(21)22-5-2/h6-13H,4-5H2,1-2H3 |
| InChIKey | QVPUTBPAXGBVJP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|