C28H38N2O8 — CID 10554216
benzyl N-[(2S)-1-[2-[2-[2-[2-(4-formylphenoxy)ethoxy]ethoxy]ethoxy]ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 10554216) has the molecular formula C28H38N2O8 and a molecular weight of 530.62 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[2-[2-[2-[2-(4-formylphenoxy)ethoxy]ethoxy]ethoxy]ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[2-[2-[2-[2-(4-formylphenoxy)ethoxy]ethoxy]ethoxy]ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10554216 |
| Molecular Formula | C28H38N2O8 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | benzyl N-[(2S)-1-[2-[2-[2-[2-(4-formylphenoxy)ethoxy]ethoxy]ethoxy]ethylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)NCCOCCOCCOCCOc1ccc(C=O)cc1 |
| InChI | InChI=1S/C28H38N2O8/c1-22(2)26(30-28(33)38-21-24-6-4-3-5-7-24)27(32)29-12-13-34-14-15-35-16-17-36-18-19-37-25-10-8-23(20-31)9-11-25/h3-11,20,22,26H,12-19,21H2,1-2H3,(H,29,32)(H,30,33)/t26-/m0/s1 |
| InChIKey | GPHJCORVVOGGDH-SANMLTNESA-N |
| XLogP | 2.99 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|