C19H21F9O2Se — CID 10554237
(Z)-5-ethoxy-6,6,7,7,8,8,9,9,9-nonafluoro-2,2-dimethyl-4-phenylselanylnon-4-en-3-ol (PubChem CID 10554237) has the molecular formula C19H21F9O2Se and a molecular weight of 531.32 g/mol. Its IUPAC name is (Z)-5-ethoxy-6,6,7,7,8,8,9,9,9-nonafluoro-2,2-dimethyl-4-phenylselanylnon-4-en-3-ol.
| Compound Name | (Z)-5-ethoxy-6,6,7,7,8,8,9,9,9-nonafluoro-2,2-dimethyl-4-phenylselanylnon-4-en-3-ol |
|---|---|
| PubChem CID | 10554237 |
| Molecular Formula | C19H21F9O2Se |
| Molecular Weight | 531.32 g/mol |
| Exact Mass | 532.06 |
| IUPAC Name | (Z)-5-ethoxy-6,6,7,7,8,8,9,9,9-nonafluoro-2,2-dimethyl-4-phenylselanylnon-4-en-3-ol |
| SMILES | CCO/C(=C(\[Se]c1ccccc1)C(O)C(C)(C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H21F9O2Se/c1-5-30-14(16(20,21)17(22,23)18(24,25)19(26,27)28)12(13(29)15(2,3)4)31-11-9-7-6-8-10-11/h6-10,13,29H,5H2,1-4H3/b14-12- |
| InChIKey | SZUUFBVXQVPRAM-OWBHPGMISA-N |
| XLogP | 5.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.32 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|