C18H21F7O2Se — CID 10838464
(E)-5-ethoxy-6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-4-phenylselanyloct-4-en-3-ol (PubChem CID 10838464) has the molecular formula C18H21F7O2Se and a molecular weight of 481.31 g/mol. Its IUPAC name is (E)-5-ethoxy-6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-4-phenylselanyloct-4-en-3-ol.
| Compound Name | (E)-5-ethoxy-6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-4-phenylselanyloct-4-en-3-ol |
|---|---|
| PubChem CID | 10838464 |
| Molecular Formula | C18H21F7O2Se |
| Molecular Weight | 481.31 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | (E)-5-ethoxy-6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-4-phenylselanyloct-4-en-3-ol |
| SMILES | CCO/C(=C(/[Se]c1ccccc1)C(O)C(C)(C)C)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H21F7O2Se/c1-5-27-14(16(19,20)17(21,22)18(23,24)25)12(13(26)15(2,3)4)28-11-9-7-6-8-10-11/h6-10,13,26H,5H2,1-4H3/b14-12+ |
| InChIKey | LZVKHJMONZWYFH-WYMLVPIESA-N |
| XLogP | 4.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|