C15H22O2Se — CID 10828971
(Z)-1-ethoxy-4,4-dimethyl-2-phenylselanylpent-1-en-3-ol (PubChem CID 10828971) has the molecular formula C15H22O2Se and a molecular weight of 313.30 g/mol. Its IUPAC name is (Z)-1-ethoxy-4,4-dimethyl-2-phenylselanylpent-1-en-3-ol.
| Compound Name | (Z)-1-ethoxy-4,4-dimethyl-2-phenylselanylpent-1-en-3-ol |
|---|---|
| PubChem CID | 10828971 |
| Molecular Formula | C15H22O2Se |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | (Z)-1-ethoxy-4,4-dimethyl-2-phenylselanylpent-1-en-3-ol |
| SMILES | CCO/C=C(\[Se]c1ccccc1)C(O)C(C)(C)C |
| InChI | InChI=1S/C15H22O2Se/c1-5-17-11-13(14(16)15(2,3)4)18-12-9-7-6-8-10-12/h6-11,14,16H,5H2,1-4H3/b13-11- |
| InChIKey | YYZFFCNTUSGCNU-QBFSEMIESA-N |
| XLogP | 2.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|