C14H20O2 — CID 15207026
(Z)-2-methoxy-4,4-dimethyl-1-phenylpent-1-en-3-ol (PubChem CID 15207026) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (Z)-2-methoxy-4,4-dimethyl-1-phenylpent-1-en-3-ol.
| Compound Name | (Z)-2-methoxy-4,4-dimethyl-1-phenylpent-1-en-3-ol |
|---|---|
| PubChem CID | 15207026 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (Z)-2-methoxy-4,4-dimethyl-1-phenylpent-1-en-3-ol |
| SMILES | CO/C(=C\c1ccccc1)C(O)C(C)(C)C |
| InChI | InChI=1S/C14H20O2/c1-14(2,3)13(15)12(16-4)10-11-8-6-5-7-9-11/h5-10,13,15H,1-4H3/b12-10- |
| InChIKey | QLLCGLKSVBOFHC-BENRWUELSA-N |
| XLogP | 3.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|