C20H19F3O2Se — CID 10788587
(1E,4E)-5-ethoxy-6,6,6-trifluoro-1-phenyl-4-phenylselanylhexa-1,4-dien-3-ol (PubChem CID 10788587) has the molecular formula C20H19F3O2Se and a molecular weight of 427.32 g/mol. Its IUPAC name is (1E,4E)-5-ethoxy-6,6,6-trifluoro-1-phenyl-4-phenylselanylhexa-1,4-dien-3-ol.
| Compound Name | (1E,4E)-5-ethoxy-6,6,6-trifluoro-1-phenyl-4-phenylselanylhexa-1,4-dien-3-ol |
|---|---|
| PubChem CID | 10788587 |
| Molecular Formula | C20H19F3O2Se |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | (1E,4E)-5-ethoxy-6,6,6-trifluoro-1-phenyl-4-phenylselanylhexa-1,4-dien-3-ol |
| SMILES | CCO/C(=C(/[Se]c1ccccc1)C(O)/C=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H19F3O2Se/c1-2-25-19(20(21,22)23)18(26-16-11-7-4-8-12-16)17(24)14-13-15-9-5-3-6-10-15/h3-14,17,24H,2H2,1H3/b14-13+,19-18+ |
| InChIKey | BDRLTYBTJILPNN-CDSOMVEVSA-N |
| XLogP | 3.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|