About (Z)-2-methyl-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol
(Z)-2-methyl-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol (PubChem CID 134931988) has the molecular formula C19H16F6OSe2
and a molecular weight of 532.24 g/mol. Its IUPAC name is (Z)-2-methyl-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol.
Molecular Properties
| Compound Name | (Z)-2-methyl-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol |
| PubChem CID | 134931988 |
| Molecular Formula | C19H16F6OSe2 |
| Molecular Weight | 532.24 g/mol |
| Exact Mass | 533.94 |
| IUPAC Name | (Z)-2-methyl-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol |
| SMILES | CC(C)(O)/C(=C/[Se]c1ccc(C(F)(F)F)cc1)[Se]c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F6OSe2/c1-17(2,26)16(28-15-9-5-13(6-10-15)19(23,24)25)11-27-14-7-3-12(4-8-14)18(20,21)22/h3-11,26H,1-2H3/b16-11- |
| InChIKey | OFMQXPVCLVKWDE-WJDWOHSUSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 532.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-methyl-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-methyl-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol?
The IUPAC name of (Z)-2-methyl-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol (CID 134931988) is (Z)-2-methyl-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol.
What is the SMILES notation for (Z)-2-methyl-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol?
The canonical SMILES for (Z)-2-methyl-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol is CC(C)(O)/C(=C/[Se]c1ccc(C(F)(F)F)cc1)[Se]c1ccc(C(F)(F)F)cc1.
What is the InChIKey of (Z)-2-methyl-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol?
The InChIKey is OFMQXPVCLVKWDE-WJDWOHSUSA-N. The full InChI is InChI=1S/C19H16F6OSe2/c1-17(2,26)16(28-15-9-5-13(6-10-15)19(23,24)25)11-27-14-7-3-12(4-8-14)18(20,21)22/h3-11,26H,1-2H3/b16-11-.
What are the key properties of (Z)-2-methyl-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol?
(Z)-2-methyl-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol has a molecular weight of 532.24 g/mol, XLogP of 3.70, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-methyl-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol is sourced from PubChem (CID 134931988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).