C18H14F6OSe2 — CID 134931874
(E)-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol (PubChem CID 134931874) has the molecular formula C18H14F6OSe2 and a molecular weight of 518.22 g/mol. Its IUPAC name is (E)-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol.
| Compound Name | (E)-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol |
|---|---|
| PubChem CID | 134931874 |
| Molecular Formula | C18H14F6OSe2 |
| Molecular Weight | 518.22 g/mol |
| Exact Mass | 519.93 |
| IUPAC Name | (E)-3,4-bis[[4-(trifluoromethyl)phenyl]selanyl]but-3-en-2-ol |
| SMILES | CC(O)/C(=C\[Se]c1ccc(C(F)(F)F)cc1)[Se]c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14F6OSe2/c1-11(25)16(27-15-8-4-13(5-9-15)18(22,23)24)10-26-14-6-2-12(3-7-14)17(19,20)21/h2-11,25H,1H3/b16-10+ |
| InChIKey | AZSXHYGZJJAICQ-MHWRWJLKSA-N |
| XLogP | 3.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|