C17H21F5O2Se — CID 10598779
(E)-5-ethoxy-6,6,7,7,7-pentafluoro-2,2-dimethyl-4-phenylselanylhept-4-en-3-ol (PubChem CID 10598779) has the molecular formula C17H21F5O2Se and a molecular weight of 431.30 g/mol. Its IUPAC name is (E)-5-ethoxy-6,6,7,7,7-pentafluoro-2,2-dimethyl-4-phenylselanylhept-4-en-3-ol.
| Compound Name | (E)-5-ethoxy-6,6,7,7,7-pentafluoro-2,2-dimethyl-4-phenylselanylhept-4-en-3-ol |
|---|---|
| PubChem CID | 10598779 |
| Molecular Formula | C17H21F5O2Se |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | (E)-5-ethoxy-6,6,7,7,7-pentafluoro-2,2-dimethyl-4-phenylselanylhept-4-en-3-ol |
| SMILES | CCO/C(=C(/[Se]c1ccccc1)C(O)C(C)(C)C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H21F5O2Se/c1-5-24-14(16(18,19)17(20,21)22)12(13(23)15(2,3)4)25-11-9-7-6-8-10-11/h6-10,13,23H,5H2,1-4H3/b14-12+ |
| InChIKey | RTEJFEUIBYZHMQ-WYMLVPIESA-N |
| XLogP | 3.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|