C28H24N4O4S2 — CID 10554550
thiophen-2-ylmethyl (1S,3S,7S,8R)-4,9-bis(4-methylphenyl)-12-oxo-13-oxa-2-thia-4,5,9,10-tetrazatetracyclo[6.6.0.01,11.03,7]tetradeca-5,10-diene-6-carboxylate (PubChem CID 10554550) has the molecular formula C28H24N4O4S2 and a molecular weight of 544.66 g/mol. Its IUPAC name is thiophen-2-ylmethyl (1S,3S,7S,8R)-4,9-bis(4-methylphenyl)-12-oxo-13-oxa-2-thia-4,5,9,10-tetrazatetracyclo[6.6.0.01,11.03,7]tetradeca-5,10-diene-6-carboxylate.
| Compound Name | thiophen-2-ylmethyl (1S,3S,7S,8R)-4,9-bis(4-methylphenyl)-12-oxo-13-oxa-2-thia-4,5,9,10-tetrazatetracyclo[6.6.0.01,11.03,7]tetradeca-5,10-diene-6-carboxylate |
|---|---|
| PubChem CID | 10554550 |
| Molecular Formula | C28H24N4O4S2 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | thiophen-2-ylmethyl (1S,3S,7S,8R)-4,9-bis(4-methylphenyl)-12-oxo-13-oxa-2-thia-4,5,9,10-tetrazatetracyclo[6.6.0.01,11.03,7]tetradeca-5,10-diene-6-carboxylate |
| SMILES | Cc1ccc(N2N=C(C(=O)OCc3cccs3)[C@H]3[C@@H]2S[C@]24COC(=O)C2=NN(c2ccc(C)cc2)[C@H]34)cc1 |
| InChI | InChI=1S/C28H24N4O4S2/c1-16-5-9-18(10-6-16)31-24-21-22(26(33)35-14-20-4-3-13-37-20)29-32(19-11-7-17(2)8-12-19)25(21)38-28(24)15-36-27(34)23(28)30-31/h3-13,21,24-25H,14-15H2,1-2H3/t21-,24-,25+,28-/m1/s1 |
| InChIKey | BLBHTUWFNVAORU-DAHKTCFSSA-N |
| XLogP | 4.51 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |