C26H18Cl2N4O4S2 — CID 10650964
thiophen-2-ylmethyl (1S,3S,7S,8R)-4,9-bis(4-chlorophenyl)-12-oxo-13-oxa-2-thia-4,5,9,10-tetrazatetracyclo[6.6.0.01,11.03,7]tetradeca-5,10-diene-6-carboxylate (PubChem CID 10650964) has the molecular formula C26H18Cl2N4O4S2 and a molecular weight of 585.49 g/mol. Its IUPAC name is thiophen-2-ylmethyl (1S,3S,7S,8R)-4,9-bis(4-chlorophenyl)-12-oxo-13-oxa-2-thia-4,5,9,10-tetrazatetracyclo[6.6.0.01,11.03,7]tetradeca-5,10-diene-6-carboxylate.
| Compound Name | thiophen-2-ylmethyl (1S,3S,7S,8R)-4,9-bis(4-chlorophenyl)-12-oxo-13-oxa-2-thia-4,5,9,10-tetrazatetracyclo[6.6.0.01,11.03,7]tetradeca-5,10-diene-6-carboxylate |
|---|---|
| PubChem CID | 10650964 |
| Molecular Formula | C26H18Cl2N4O4S2 |
| Molecular Weight | 585.49 g/mol |
| Exact Mass | 584.01 |
| IUPAC Name | thiophen-2-ylmethyl (1S,3S,7S,8R)-4,9-bis(4-chlorophenyl)-12-oxo-13-oxa-2-thia-4,5,9,10-tetrazatetracyclo[6.6.0.01,11.03,7]tetradeca-5,10-diene-6-carboxylate |
| SMILES | O=C(OCc1cccs1)C1=NN(c2ccc(Cl)cc2)[C@H]2S[C@]34COC(=O)C3=NN(c3ccc(Cl)cc3)[C@@H]4[C@@H]12 |
| InChI | InChI=1S/C26H18Cl2N4O4S2/c27-14-3-7-16(8-4-14)31-22-19-20(24(33)35-12-18-2-1-11-37-18)29-32(17-9-5-15(28)6-10-17)23(19)38-26(22)13-36-25(34)21(26)30-31/h1-11,19,22-23H,12-13H2/t19-,22-,23+,26-/m1/s1 |
| InChIKey | WXDPXXRCYJXJPU-BLZYYQICSA-N |
| XLogP | 5.20 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |