C27H31F3N2O6S2 — CID 10555557
(2R)-4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]-N-[(7S)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]butanamide (PubChem CID 10555557) has the molecular formula C27H31F3N2O6S2 and a molecular weight of 600.68 g/mol. Its IUPAC name is (2R)-4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]-N-[(7S)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]butanamide.
| Compound Name | (2R)-4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]-N-[(7S)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]butanamide |
|---|---|
| PubChem CID | 10555557 |
| Molecular Formula | C27H31F3N2O6S2 |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.16 |
| IUPAC Name | (2R)-4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]-N-[(7S)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]butanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(SC)c(=O)cc1[C@@H](NC(=O)[C@@H](CCSC)NC(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C27H31F3N2O6S2/c1-36-20-12-14-6-8-17(31-25(34)18(10-11-39-4)32-26(35)27(28,29)30)16-13-19(33)21(40-5)9-7-15(16)22(14)24(38-3)23(20)37-2/h7,9,12-13,17-18H,6,8,10-11H2,1-5H3,(H,31,34)(H,32,35)/t17-,18+/m0/s1 |
| InChIKey | KWPZRQLUTVXXSZ-ZWKOTPCHSA-N |
| XLogP | 4.37 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |