C33H29Cl2N7O2 — CID 10555931
8-chloro-N-[3-[3-[(8-chlorophenazine-1-carbonyl)amino]propyl-methylamino]propyl]phenazine-1-carboxamide (PubChem CID 10555931) has the molecular formula C33H29Cl2N7O2 and a molecular weight of 626.55 g/mol. Its IUPAC name is 8-chloro-N-[3-[3-[(8-chlorophenazine-1-carbonyl)amino]propyl-methylamino]propyl]phenazine-1-carboxamide.
| Compound Name | 8-chloro-N-[3-[3-[(8-chlorophenazine-1-carbonyl)amino]propyl-methylamino]propyl]phenazine-1-carboxamide |
|---|---|
| PubChem CID | 10555931 |
| Molecular Formula | C33H29Cl2N7O2 |
| Molecular Weight | 626.55 g/mol |
| Exact Mass | 625.18 |
| IUPAC Name | 8-chloro-N-[3-[3-[(8-chlorophenazine-1-carbonyl)amino]propyl-methylamino]propyl]phenazine-1-carboxamide |
| SMILES | CN(CCCNC(=O)c1cccc2nc3ccc(Cl)cc3nc12)CCCNC(=O)c1cccc2nc3ccc(Cl)cc3nc12 |
| InChI | InChI=1S/C33H29Cl2N7O2/c1-42(16-4-14-36-32(43)22-6-2-8-26-30(22)40-28-18-20(34)10-12-24(28)38-26)17-5-15-37-33(44)23-7-3-9-27-31(23)41-29-19-21(35)11-13-25(29)39-27/h2-3,6-13,18-19H,4-5,14-17H2,1H3,(H,36,43)(H,37,44) |
| InChIKey | HRMKUQMCKBKIBX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|