C36H30Cl2N10O10S4Zn — CID 10557985
zinc bis([4-[(4-chlorophenyl)sulfonylcarbamoylamino]phenyl]sulfonyl-(4-methylpyrimidin-2-yl)azanide) (PubChem CID 10557985) has the molecular formula C36H30Cl2N10O10S4Zn and a molecular weight of 1027.26 g/mol. Its IUPAC name is zinc bis([4-[(4-chlorophenyl)sulfonylcarbamoylamino]phenyl]sulfonyl-(4-methylpyrimidin-2-yl)azanide).
| Compound Name | zinc bis([4-[(4-chlorophenyl)sulfonylcarbamoylamino]phenyl]sulfonyl-(4-methylpyrimidin-2-yl)azanide) |
|---|---|
| PubChem CID | 10557985 |
| Molecular Formula | C36H30Cl2N10O10S4Zn |
| Molecular Weight | 1027.26 g/mol |
| Exact Mass | 1023.97 |
| IUPAC Name | zinc bis([4-[(4-chlorophenyl)sulfonylcarbamoylamino]phenyl]sulfonyl-(4-methylpyrimidin-2-yl)azanide) |
| SMILES | Cc1ccnc([N-]S(=O)(=O)c2ccc(NC(=O)NS(=O)(=O)c3ccc(Cl)cc3)cc2)n1.Cc1ccnc([N-]S(=O)(=O)c2ccc(NC(=O)NS(=O)(=O)c3ccc(Cl)cc3)cc2)n1.[Zn+2] |
| InChI | InChI=1S/2C18H16ClN5O5S2.Zn/c2*1-12-10-11-20-17(21-12)23-30(26,27)16-8-4-14(5-9-16)22-18(25)24-31(28,29)15-6-2-13(19)3-7-15;/h2*2-11H,1H3,(H3,20,21,22,23,24,25);/q;;+2/p-2 |
| InChIKey | NKWOITJBJZZBTR-UHFFFAOYSA-L |
| XLogP | 6.68 |
| TPSA | 298.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.26 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|