C14H15N4O4S- — CID 4746240
[4-(ethoxycarbonylamino)phenyl]sulfonyl-(4-methylpyrimidin-2-yl)azanide (PubChem CID 4746240) has the molecular formula C14H15N4O4S- and a molecular weight of 335.37 g/mol. Its IUPAC name is [4-(ethoxycarbonylamino)phenyl]sulfonyl-(4-methylpyrimidin-2-yl)azanide.
| Compound Name | [4-(ethoxycarbonylamino)phenyl]sulfonyl-(4-methylpyrimidin-2-yl)azanide |
|---|---|
| PubChem CID | 4746240 |
| Molecular Formula | C14H15N4O4S- |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | [4-(ethoxycarbonylamino)phenyl]sulfonyl-(4-methylpyrimidin-2-yl)azanide |
| SMILES | CCOC(=O)Nc1ccc(S(=O)(=O)[N-]c2nccc(C)n2)cc1 |
| InChI | InChI=1S/C14H16N4O4S/c1-3-22-14(19)17-11-4-6-12(7-5-11)23(20,21)18-13-15-9-8-10(2)16-13/h4-9H,3H2,1-2H3,(H2,15,16,17,18,19)/p-1 |
| InChIKey | CNNBOBAVSJCNBF-UHFFFAOYSA-M |
| XLogP | 2.75 |
| TPSA | 112.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |