C19H16ClN4O4S- — CID 4755554
[4-[(5-chloro-2-methoxybenzoyl)amino]phenyl]sulfonyl-(4-methylpyrimidin-2-yl)azanide (PubChem CID 4755554) has the molecular formula C19H16ClN4O4S- and a molecular weight of 431.88 g/mol. Its IUPAC name is [4-[(5-chloro-2-methoxybenzoyl)amino]phenyl]sulfonyl-(4-methylpyrimidin-2-yl)azanide.
| Compound Name | [4-[(5-chloro-2-methoxybenzoyl)amino]phenyl]sulfonyl-(4-methylpyrimidin-2-yl)azanide |
|---|---|
| PubChem CID | 4755554 |
| Molecular Formula | C19H16ClN4O4S- |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | [4-[(5-chloro-2-methoxybenzoyl)amino]phenyl]sulfonyl-(4-methylpyrimidin-2-yl)azanide |
| SMILES | COc1ccc(Cl)cc1C(=O)Nc1ccc(S(=O)(=O)[N-]c2nccc(C)n2)cc1 |
| InChI | InChI=1S/C19H17ClN4O4S/c1-12-9-10-21-19(22-12)24-29(26,27)15-6-4-14(5-7-15)23-18(25)16-11-13(20)3-8-17(16)28-2/h3-11H,1-2H3,(H2,21,22,23,24,25)/p-1 |
| InChIKey | QOWYFYMWVAWUDU-UHFFFAOYSA-M |
| XLogP | 4.09 |
| TPSA | 112.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |