C13H13N4O3S- — CID 3691554
(4-acetamidophenyl)sulfonyl-(4-methylpyrimidin-2-yl)azanide (PubChem CID 3691554) has the molecular formula C13H13N4O3S- and a molecular weight of 305.34 g/mol. Its IUPAC name is (4-acetamidophenyl)sulfonyl-(4-methylpyrimidin-2-yl)azanide.
| Compound Name | (4-acetamidophenyl)sulfonyl-(4-methylpyrimidin-2-yl)azanide |
|---|---|
| PubChem CID | 3691554 |
| Molecular Formula | C13H13N4O3S- |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | (4-acetamidophenyl)sulfonyl-(4-methylpyrimidin-2-yl)azanide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)[N-]c2nccc(C)n2)cc1 |
| InChI | InChI=1S/C13H14N4O3S/c1-9-7-8-14-13(15-9)17-21(19,20)12-5-3-11(4-6-12)16-10(2)18/h3-8H,1-2H3,(H2,14,15,16,17,18)/p-1 |
| InChIKey | HYBBXHMCIRBHIW-UHFFFAOYSA-M |
| XLogP | 2.14 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |