C15H17N4O3S- — CID 5061548
[4-(2,2-dimethylpropanoylamino)phenyl]sulfonyl-pyrimidin-2-ylazanide (PubChem CID 5061548) has the molecular formula C15H17N4O3S- and a molecular weight of 333.39 g/mol. Its IUPAC name is [4-(2,2-dimethylpropanoylamino)phenyl]sulfonyl-pyrimidin-2-ylazanide.
| Compound Name | [4-(2,2-dimethylpropanoylamino)phenyl]sulfonyl-pyrimidin-2-ylazanide |
|---|---|
| PubChem CID | 5061548 |
| Molecular Formula | C15H17N4O3S- |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | [4-(2,2-dimethylpropanoylamino)phenyl]sulfonyl-pyrimidin-2-ylazanide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(S(=O)(=O)[N-]c2ncccn2)cc1 |
| InChI | InChI=1S/C15H18N4O3S/c1-15(2,3)13(20)18-11-5-7-12(8-6-11)23(21,22)19-14-16-9-4-10-17-14/h4-10H,1-3H3,(H2,16,17,18,19,20)/p-1 |
| InChIKey | FDSIEUNEWVHHIC-UHFFFAOYSA-M |
| XLogP | 2.86 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |