C19H18N5O2S2- — CID 2426028
[4-[(2,4-dimethylphenyl)carbamothioylamino]phenyl]sulfonyl-pyrimidin-2-ylazanide (PubChem CID 2426028) has the molecular formula C19H18N5O2S2- and a molecular weight of 412.52 g/mol. Its IUPAC name is [4-[(2,4-dimethylphenyl)carbamothioylamino]phenyl]sulfonyl-pyrimidin-2-ylazanide.
| Compound Name | [4-[(2,4-dimethylphenyl)carbamothioylamino]phenyl]sulfonyl-pyrimidin-2-ylazanide |
|---|---|
| PubChem CID | 2426028 |
| Molecular Formula | C19H18N5O2S2- |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [4-[(2,4-dimethylphenyl)carbamothioylamino]phenyl]sulfonyl-pyrimidin-2-ylazanide |
| SMILES | Cc1ccc(NC(=S)Nc2ccc(S(=O)(=O)[N-]c3ncccn3)cc2)c(C)c1 |
| InChI | InChI=1S/C19H19N5O2S2/c1-13-4-9-17(14(2)12-13)23-19(27)22-15-5-7-16(8-6-15)28(25,26)24-18-20-10-3-11-21-18/h3-12H,1-2H3,(H3,20,21,22,23,24,27)/p-1 |
| InChIKey | OEZJYMRIZZLNDB-UHFFFAOYSA-M |
| XLogP | 4.30 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|