C19H17N4O5S- — CID 5209976
[4-[(2,6-dimethoxybenzoyl)amino]phenyl]sulfonyl-pyrimidin-2-ylazanide (PubChem CID 5209976) has the molecular formula C19H17N4O5S- and a molecular weight of 413.44 g/mol. Its IUPAC name is [4-[(2,6-dimethoxybenzoyl)amino]phenyl]sulfonyl-pyrimidin-2-ylazanide.
| Compound Name | [4-[(2,6-dimethoxybenzoyl)amino]phenyl]sulfonyl-pyrimidin-2-ylazanide |
|---|---|
| PubChem CID | 5209976 |
| Molecular Formula | C19H17N4O5S- |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | [4-[(2,6-dimethoxybenzoyl)amino]phenyl]sulfonyl-pyrimidin-2-ylazanide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc(S(=O)(=O)[N-]c2ncccn2)cc1 |
| InChI | InChI=1S/C19H18N4O5S/c1-27-15-5-3-6-16(28-2)17(15)18(24)22-13-7-9-14(10-8-13)29(25,26)23-19-20-11-4-12-21-19/h3-12H,1-2H3,(H2,20,21,22,23,24)/p-1 |
| InChIKey | KAQGTQMRXNVRPU-UHFFFAOYSA-M |
| XLogP | 3.14 |
| TPSA | 121.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |