C22H18N5O5S- — CID 4067833
(4,6-dimethylpyrimidin-2-yl)-[4-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]phenyl]sulfonylazanide (PubChem CID 4067833) has the molecular formula C22H18N5O5S- and a molecular weight of 464.48 g/mol. Its IUPAC name is (4,6-dimethylpyrimidin-2-yl)-[4-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]phenyl]sulfonylazanide.
| Compound Name | (4,6-dimethylpyrimidin-2-yl)-[4-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]phenyl]sulfonylazanide |
|---|---|
| PubChem CID | 4067833 |
| Molecular Formula | C22H18N5O5S- |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | (4,6-dimethylpyrimidin-2-yl)-[4-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]phenyl]sulfonylazanide |
| SMILES | Cc1cc(C)nc([N-]S(=O)(=O)c2ccc(NC(=O)CN3C(=O)c4ccccc4C3=O)cc2)n1 |
| InChI | InChI=1S/C22H19N5O5S/c1-13-11-14(2)24-22(23-13)26-33(31,32)16-9-7-15(8-10-16)25-19(28)12-27-20(29)17-5-3-4-6-18(17)21(27)30/h3-11H,12H2,1-2H3,(H2,23,24,25,26,28)/p-1 |
| InChIKey | WSIDMMSDKCXQHS-UHFFFAOYSA-M |
| XLogP | 2.72 |
| TPSA | 140.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|