C13H16O2 — CID 10560122
(5E)-8-methoxy-2,3,4,7-tetrahydro-1-benzoxonine (PubChem CID 10560122) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (5E)-8-methoxy-2,3,4,7-tetrahydro-1-benzoxonine.
| Compound Name | (5E)-8-methoxy-2,3,4,7-tetrahydro-1-benzoxonine |
|---|---|
| PubChem CID | 10560122 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (5E)-8-methoxy-2,3,4,7-tetrahydro-1-benzoxonine |
| SMILES | COc1cccc2c1C/C=C/CCCO2 |
| InChI | InChI=1S/C13H16O2/c1-14-12-8-6-9-13-11(12)7-4-2-3-5-10-15-13/h2,4,6,8-9H,3,5,7,10H2,1H3/b4-2+ |
| InChIKey | MZTNWYUSPLBBAO-DUXPYHPUSA-N |
| XLogP | 2.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|