C11H14N2O2 — CID 10560208
5-methylidene-1,3-bis(prop-2-enyl)-1,3-diazinane-2,4-dione (PubChem CID 10560208) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 5-methylidene-1,3-bis(prop-2-enyl)-1,3-diazinane-2,4-dione.
| Compound Name | 5-methylidene-1,3-bis(prop-2-enyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 10560208 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 5-methylidene-1,3-bis(prop-2-enyl)-1,3-diazinane-2,4-dione |
| SMILES | C=CCN1CC(=C)C(=O)N(CC=C)C1=O |
| InChI | InChI=1S/C11H14N2O2/c1-4-6-12-8-9(3)10(14)13(7-5-2)11(12)15/h4-5H,1-3,6-8H2 |
| InChIKey | SHAKHALWIVIDFO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|