C7H8N2O3 — CID 12910100
1,3-dimethyl-5-methylidene-1,3-diazinane-2,4,6-trione (PubChem CID 12910100) has the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. Its IUPAC name is 1,3-dimethyl-5-methylidene-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-methylidene-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 12910100 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 1,3-dimethyl-5-methylidene-1,3-diazinane-2,4,6-trione |
| SMILES | C=C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C7H8N2O3/c1-4-5(10)8(2)7(12)9(3)6(4)11/h1H2,2-3H3 |
| InChIKey | NBBYUFSONWTACO-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|