C13H16O4 — CID 10561778
methyl (1R,5S,6R,8R)-10-methylidene-2-oxo-3-oxatricyclo[6.3.0.01,5]undecane-6-carboxylate (PubChem CID 10561778) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is methyl (1R,5S,6R,8R)-10-methylidene-2-oxo-3-oxatricyclo[6.3.0.01,5]undecane-6-carboxylate.
| Compound Name | methyl (1R,5S,6R,8R)-10-methylidene-2-oxo-3-oxatricyclo[6.3.0.01,5]undecane-6-carboxylate |
|---|---|
| PubChem CID | 10561778 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | methyl (1R,5S,6R,8R)-10-methylidene-2-oxo-3-oxatricyclo[6.3.0.01,5]undecane-6-carboxylate |
| SMILES | C=C1C[C@H]2C[C@@H](C(=O)OC)[C@@H]3COC(=O)[C@]23C1 |
| InChI | InChI=1S/C13H16O4/c1-7-3-8-4-9(11(14)16-2)10-6-17-12(15)13(8,10)5-7/h8-10H,1,3-6H2,2H3/t8-,9+,10-,13+/m0/s1 |
| InChIKey | JTSYLQWSKLWOPE-MPXOCVNLSA-N |
| XLogP | 1.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|