C16H32OSi — CID 10563864
[(1R,3R)-3-but-3-enylcyclohexyl]oxy-tert-butyl-dimethylsilane (PubChem CID 10563864) has the molecular formula C16H32OSi and a molecular weight of 268.52 g/mol. Its IUPAC name is [(1R,3R)-3-but-3-enylcyclohexyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3R)-3-but-3-enylcyclohexyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10563864 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | [(1R,3R)-3-but-3-enylcyclohexyl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CCC[C@H]1CCC[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C16H32OSi/c1-7-8-10-14-11-9-12-15(13-14)17-18(5,6)16(2,3)4/h7,14-15H,1,8-13H2,2-6H3/t14-,15+/m0/s1 |
| InChIKey | QUPIEEPPXHVYQO-LSDHHAIUSA-N |
| XLogP | 5.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|