C13H16N4O3 — CID 10564387
4-ethoxy-7-(2-methoxyethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carbonitrile (PubChem CID 10564387) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-ethoxy-7-(2-methoxyethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carbonitrile.
| Compound Name | 4-ethoxy-7-(2-methoxyethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 10564387 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 4-ethoxy-7-(2-methoxyethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| SMILES | CCOc1ncnc2c1c(C#N)cn2COCCOC |
| InChI | InChI=1S/C13H16N4O3/c1-3-20-13-11-10(6-14)7-17(9-19-5-4-18-2)12(11)15-8-16-13/h7-8H,3-5,9H2,1-2H3 |
| InChIKey | UXZLSPPCWAREJH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 82.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|