C10H15N5O3S — CID 100982242
4-amino-7-(2-methoxyethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-sulfinamide (PubChem CID 100982242) has the molecular formula C10H15N5O3S and a molecular weight of 285.33 g/mol. Its IUPAC name is 4-amino-7-(2-methoxyethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-sulfinamide.
| Compound Name | 4-amino-7-(2-methoxyethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-sulfinamide |
|---|---|
| PubChem CID | 100982242 |
| Molecular Formula | C10H15N5O3S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 4-amino-7-(2-methoxyethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-sulfinamide |
| SMILES | COCCOCn1cc(S(N)=O)c2c(N)ncnc21 |
| InChI | InChI=1S/C10H15N5O3S/c1-17-2-3-18-6-15-4-7(19(12)16)8-9(11)13-5-14-10(8)15/h4-5H,2-3,6,12H2,1H3,(H2,11,13,14) |
| InChIKey | LSMZDKFKSWITDJ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|