C17H26O3 — CID 10564569
(6R,8R,11S)-2-but-3-enyl-8-methyl-11-propan-2-yl-1,5-dioxaspiro[5.5]undec-2-en-4-one (PubChem CID 10564569) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (6R,8R,11S)-2-but-3-enyl-8-methyl-11-propan-2-yl-1,5-dioxaspiro[5.5]undec-2-en-4-one.
| Compound Name | (6R,8R,11S)-2-but-3-enyl-8-methyl-11-propan-2-yl-1,5-dioxaspiro[5.5]undec-2-en-4-one |
|---|---|
| PubChem CID | 10564569 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (6R,8R,11S)-2-but-3-enyl-8-methyl-11-propan-2-yl-1,5-dioxaspiro[5.5]undec-2-en-4-one |
| SMILES | C=CCCC1=CC(=O)O[C@@]2(C[C@H](C)CC[C@H]2C(C)C)O1 |
| InChI | InChI=1S/C17H26O3/c1-5-6-7-14-10-16(18)20-17(19-14)11-13(4)8-9-15(17)12(2)3/h5,10,12-13,15H,1,6-9,11H2,2-4H3/t13-,15+,17-/m1/s1 |
| InChIKey | ZAHGNKRXNAZXJG-UKPHBRMFSA-N |
| XLogP | 4.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|