C11H23BrO3Si — CID 10566985
2-trimethylsilylethyl (2R,3S)-2-bromo-3-hydroxy-4-methylpentanoate (PubChem CID 10566985) has the molecular formula C11H23BrO3Si and a molecular weight of 311.29 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2R,3S)-2-bromo-3-hydroxy-4-methylpentanoate.
| Compound Name | 2-trimethylsilylethyl (2R,3S)-2-bromo-3-hydroxy-4-methylpentanoate |
|---|---|
| PubChem CID | 10566985 |
| Molecular Formula | C11H23BrO3Si |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2-trimethylsilylethyl (2R,3S)-2-bromo-3-hydroxy-4-methylpentanoate |
| SMILES | CC(C)[C@H](O)[C@@H](Br)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C11H23BrO3Si/c1-8(2)10(13)9(12)11(14)15-6-7-16(3,4)5/h8-10,13H,6-7H2,1-5H3/t9-,10+/m1/s1 |
| InChIKey | WRFRLJBLGBDTSH-ZJUUUORDSA-N |
| XLogP | 2.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|