C15H31BrO4Si — CID 10915958
ethyl (2S,3R,4S)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4-dimethylpentanoate (PubChem CID 10915958) has the molecular formula C15H31BrO4Si and a molecular weight of 383.40 g/mol. Its IUPAC name is ethyl (2S,3R,4S)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4-dimethylpentanoate.
| Compound Name | ethyl (2S,3R,4S)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 10915958 |
| Molecular Formula | C15H31BrO4Si |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | ethyl (2S,3R,4S)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4-dimethylpentanoate |
| SMILES | CCOC(=O)[C@@](C)(Br)[C@H](O)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H31BrO4Si/c1-9-19-13(18)15(6,16)12(17)11(2)10-20-21(7,8)14(3,4)5/h11-12,17H,9-10H2,1-8H3/t11-,12+,15-/m0/s1 |
| InChIKey | QCKQPLBYGYMNSV-ZOWXZIJZSA-N |
| XLogP | 3.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|