C16H33BrO4Si — CID 134880358
tert-butyl (2S,3R)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylpentanoate (PubChem CID 134880358) has the molecular formula C16H33BrO4Si and a molecular weight of 397.43 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylpentanoate.
| Compound Name | tert-butyl (2S,3R)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylpentanoate |
|---|---|
| PubChem CID | 134880358 |
| Molecular Formula | C16H33BrO4Si |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | tert-butyl (2S,3R)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylpentanoate |
| SMILES | CC(C)(C)OC(=O)[C@@](C)(Br)[C@H](O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33BrO4Si/c1-14(2,3)21-13(19)16(7,17)12(18)10-11-20-22(8,9)15(4,5)6/h12,18H,10-11H2,1-9H3/t12-,16+/m1/s1 |
| InChIKey | RLYSFBJZSIKDFQ-WBMJQRKESA-N |
| XLogP | 4.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|