C15H32O4Si — CID 10662325
2-methylpropyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypentanoate (PubChem CID 10662325) has the molecular formula C15H32O4Si and a molecular weight of 304.50 g/mol. Its IUPAC name is 2-methylpropyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypentanoate.
| Compound Name | 2-methylpropyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypentanoate |
|---|---|
| PubChem CID | 10662325 |
| Molecular Formula | C15H32O4Si |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | 2-methylpropyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypentanoate |
| SMILES | CC(C)COC(=O)C[C@H](CCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32O4Si/c1-12(2)11-18-14(17)10-13(8-9-16)19-20(6,7)15(3,4)5/h12-13,16H,8-11H2,1-7H3/t13-/m0/s1 |
| InChIKey | GPMCRPNEHHFPGQ-ZDUSSCGKSA-N |
| XLogP | 3.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|