C16H31F3O4Si — CID 134943547
tert-butyl (2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-(trifluoromethyl)pentanoate (PubChem CID 134943547) has the molecular formula C16H31F3O4Si and a molecular weight of 372.50 g/mol. Its IUPAC name is tert-butyl (2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-(trifluoromethyl)pentanoate.
| Compound Name | tert-butyl (2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-(trifluoromethyl)pentanoate |
|---|---|
| PubChem CID | 134943547 |
| Molecular Formula | C16H31F3O4Si |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | tert-butyl (2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-(trifluoromethyl)pentanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H]([C@H](O)CCO[Si](C)(C)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C16H31F3O4Si/c1-14(2,3)23-13(21)12(16(17,18)19)11(20)9-10-22-24(7,8)15(4,5)6/h11-12,20H,9-10H2,1-8H3/t11-,12-/m1/s1 |
| InChIKey | PINXALKRMDGMBE-VXGBXAGGSA-N |
| XLogP | 4.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|