C13H15ClN2O5 — CID 10567304
2,3,4-trimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate (PubChem CID 10567304) has the molecular formula C13H15ClN2O5 and a molecular weight of 314.72 g/mol. Its IUPAC name is 2,3,4-trimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate.
| Compound Name | 2,3,4-trimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate |
|---|---|
| PubChem CID | 10567304 |
| Molecular Formula | C13H15ClN2O5 |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2,3,4-trimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate |
| SMILES | Cc1[nH]c(=O)c(-c2ccccc2)c(C)[n+]1C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C13H14N2O.ClHO4/c1-9-12(11-7-5-4-6-8-11)13(16)14-10(2)15(9)3;2-1(3,4)5/h4-8H,1-3H3;(H,2,3,4,5) |
| InChIKey | QJWQGPJRWXEJEH-UHFFFAOYSA-N |
| XLogP | -3.27 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|