C20H34O2Si — CID 10568767
4,4-dimethyl-1-phenyl-3-(triethylsilyloxymethyl)pentan-2-one (PubChem CID 10568767) has the molecular formula C20H34O2Si and a molecular weight of 334.58 g/mol. Its IUPAC name is 4,4-dimethyl-1-phenyl-3-(triethylsilyloxymethyl)pentan-2-one.
| Compound Name | 4,4-dimethyl-1-phenyl-3-(triethylsilyloxymethyl)pentan-2-one |
|---|---|
| PubChem CID | 10568767 |
| Molecular Formula | C20H34O2Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 4,4-dimethyl-1-phenyl-3-(triethylsilyloxymethyl)pentan-2-one |
| SMILES | CC[Si](CC)(CC)OCC(C(=O)Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C20H34O2Si/c1-7-23(8-2,9-3)22-16-18(20(4,5)6)19(21)15-17-13-11-10-12-14-17/h10-14,18H,7-9,15-16H2,1-6H3 |
| InChIKey | WZFPAVWLCZQJEU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|