C18H30O2Si — CID 10542727
3,3-dimethyl-1-phenyl-4-triethylsilyloxybutan-2-one (PubChem CID 10542727) has the molecular formula C18H30O2Si and a molecular weight of 306.52 g/mol. Its IUPAC name is 3,3-dimethyl-1-phenyl-4-triethylsilyloxybutan-2-one.
| Compound Name | 3,3-dimethyl-1-phenyl-4-triethylsilyloxybutan-2-one |
|---|---|
| PubChem CID | 10542727 |
| Molecular Formula | C18H30O2Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 3,3-dimethyl-1-phenyl-4-triethylsilyloxybutan-2-one |
| SMILES | CC[Si](CC)(CC)OCC(C)(C)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H30O2Si/c1-6-21(7-2,8-3)20-15-18(4,5)17(19)14-16-12-10-9-11-13-16/h9-13H,6-8,14-15H2,1-5H3 |
| InChIKey | RPDRIZVEUNANPY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|