C14H18ClNO5S — CID 10569699
methyl 2-chloro-4-(3-hydroxypiperidin-1-yl)-5-methylsulfonylbenzoate (PubChem CID 10569699) has the molecular formula C14H18ClNO5S and a molecular weight of 347.82 g/mol. Its IUPAC name is methyl 2-chloro-4-(3-hydroxypiperidin-1-yl)-5-methylsulfonylbenzoate.
| Compound Name | methyl 2-chloro-4-(3-hydroxypiperidin-1-yl)-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 10569699 |
| Molecular Formula | C14H18ClNO5S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | methyl 2-chloro-4-(3-hydroxypiperidin-1-yl)-5-methylsulfonylbenzoate |
| SMILES | COC(=O)c1cc(S(C)(=O)=O)c(N2CCCC(O)C2)cc1Cl |
| InChI | InChI=1S/C14H18ClNO5S/c1-21-14(18)10-6-13(22(2,19)20)12(7-11(10)15)16-5-3-4-9(17)8-16/h6-7,9,17H,3-5,8H2,1-2H3 |
| InChIKey | ZRZDUXOAKOXPGP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |