C24H33NO — CID 10569970
2,2,4,6,7-pentamethyl-3-(4-pentylphenyl)-3H-1-benzofuran-5-amine (PubChem CID 10569970) has the molecular formula C24H33NO and a molecular weight of 351.53 g/mol. Its IUPAC name is 2,2,4,6,7-pentamethyl-3-(4-pentylphenyl)-3H-1-benzofuran-5-amine.
| Compound Name | 2,2,4,6,7-pentamethyl-3-(4-pentylphenyl)-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 10569970 |
| Molecular Formula | C24H33NO |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 2,2,4,6,7-pentamethyl-3-(4-pentylphenyl)-3H-1-benzofuran-5-amine |
| SMILES | CCCCCc1ccc(C2c3c(C)c(N)c(C)c(C)c3OC2(C)C)cc1 |
| InChI | InChI=1S/C24H33NO/c1-7-8-9-10-18-11-13-19(14-12-18)21-20-17(4)22(25)15(2)16(3)23(20)26-24(21,5)6/h11-14,21H,7-10,25H2,1-6H3 |
| InChIKey | WXTTZVQWBUCLHC-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|