C24H31NO3 — CID 10596020
2,2,4,6,7-pentamethyl-5-nitro-3-(4-pentylphenyl)-3H-1-benzofuran (PubChem CID 10596020) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is 2,2,4,6,7-pentamethyl-5-nitro-3-(4-pentylphenyl)-3H-1-benzofuran.
| Compound Name | 2,2,4,6,7-pentamethyl-5-nitro-3-(4-pentylphenyl)-3H-1-benzofuran |
|---|---|
| PubChem CID | 10596020 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 2,2,4,6,7-pentamethyl-5-nitro-3-(4-pentylphenyl)-3H-1-benzofuran |
| SMILES | CCCCCc1ccc(C2c3c(C)c([N+](=O)[O-])c(C)c(C)c3OC2(C)C)cc1 |
| InChI | InChI=1S/C24H31NO3/c1-7-8-9-10-18-11-13-19(14-12-18)21-20-17(4)22(25(26)27)15(2)16(3)23(20)28-24(21,5)6/h11-14,21H,7-10H2,1-6H3 |
| InChIKey | WALLIECEVTWVQR-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|