C19H22ClNO5 — CID 10571794
benzyl 2-chloro-2-[(2S)-2-[(1R,3R)-3-methoxy-2-oxocyclohexyl]-4-oxoazetidin-1-yl]acetate (PubChem CID 10571794) has the molecular formula C19H22ClNO5 and a molecular weight of 379.84 g/mol. Its IUPAC name is benzyl 2-chloro-2-[(2S)-2-[(1R,3R)-3-methoxy-2-oxocyclohexyl]-4-oxoazetidin-1-yl]acetate.
| Compound Name | benzyl 2-chloro-2-[(2S)-2-[(1R,3R)-3-methoxy-2-oxocyclohexyl]-4-oxoazetidin-1-yl]acetate |
|---|---|
| PubChem CID | 10571794 |
| Molecular Formula | C19H22ClNO5 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | benzyl 2-chloro-2-[(2S)-2-[(1R,3R)-3-methoxy-2-oxocyclohexyl]-4-oxoazetidin-1-yl]acetate |
| SMILES | CO[C@@H]1CCC[C@H]([C@@H]2CC(=O)N2C(Cl)C(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C19H22ClNO5/c1-25-15-9-5-8-13(17(15)23)14-10-16(22)21(14)18(20)19(24)26-11-12-6-3-2-4-7-12/h2-4,6-7,13-15,18H,5,8-11H2,1H3/t13-,14+,15-,18?/m1/s1 |
| InChIKey | ZWTFOALXTHHDED-CJPRYEIISA-N |
| XLogP | 2.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|