C19H38O6Si — CID 10572505
(3R,7S,9R)-7-acetyloxy-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyldecanoic acid (PubChem CID 10572505) has the molecular formula C19H38O6Si and a molecular weight of 390.59 g/mol. Its IUPAC name is (3R,7S,9R)-7-acetyloxy-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyldecanoic acid.
| Compound Name | (3R,7S,9R)-7-acetyloxy-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyldecanoic acid |
|---|---|
| PubChem CID | 10572505 |
| Molecular Formula | C19H38O6Si |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (3R,7S,9R)-7-acetyloxy-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyldecanoic acid |
| SMILES | CC(=O)O[C@@H](CCC[C@@](C)(O)CC(=O)O)C[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O6Si/c1-14(25-26(7,8)18(3,4)5)12-16(24-15(2)20)10-9-11-19(6,23)13-17(21)22/h14,16,23H,9-13H2,1-8H3,(H,21,22)/t14-,16+,19-/m1/s1 |
| InChIKey | AXBSAWPJCRALBI-SIXWZSSISA-N |
| XLogP | 4.11 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|