C24H50O7Si2 — CID 46844205
2-trimethylsilylethyl (2S,3R,7S,9R)-7-acetyloxy-2,3-dihydroxy-3-methyl-9-triethylsilyloxydecanoate (PubChem CID 46844205) has the molecular formula C24H50O7Si2 and a molecular weight of 506.83 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2S,3R,7S,9R)-7-acetyloxy-2,3-dihydroxy-3-methyl-9-triethylsilyloxydecanoate.
| Compound Name | 2-trimethylsilylethyl (2S,3R,7S,9R)-7-acetyloxy-2,3-dihydroxy-3-methyl-9-triethylsilyloxydecanoate |
|---|---|
| PubChem CID | 46844205 |
| Molecular Formula | C24H50O7Si2 |
| Molecular Weight | 506.83 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | 2-trimethylsilylethyl (2S,3R,7S,9R)-7-acetyloxy-2,3-dihydroxy-3-methyl-9-triethylsilyloxydecanoate |
| SMILES | CC[Si](CC)(CC)O[C@H](C)C[C@H](CCC[C@@](C)(O)[C@H](O)C(=O)OCC[Si](C)(C)C)OC(C)=O |
| InChI | InChI=1S/C24H50O7Si2/c1-10-33(11-2,12-3)31-19(4)18-21(30-20(5)25)14-13-15-24(6,28)22(26)23(27)29-16-17-32(7,8)9/h19,21-22,26,28H,10-18H2,1-9H3/t19-,21+,22-,24-/m1/s1 |
| InChIKey | COWSQEWDDIUCJB-NQRVTCLYSA-N |
| XLogP | 4.88 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.83 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|