C20H19F4N3O2 — CID 10573545
5-fluoro-2-[hydroxy-[[(2R)-1-(1H-imidazol-5-yl)propan-2-yl]amino]-[4-(trifluoromethyl)phenyl]methyl]phenol (PubChem CID 10573545) has the molecular formula C20H19F4N3O2 and a molecular weight of 409.38 g/mol. Its IUPAC name is 5-fluoro-2-[hydroxy-[[(2R)-1-(1H-imidazol-5-yl)propan-2-yl]amino]-[4-(trifluoromethyl)phenyl]methyl]phenol.
| Compound Name | 5-fluoro-2-[hydroxy-[[(2R)-1-(1H-imidazol-5-yl)propan-2-yl]amino]-[4-(trifluoromethyl)phenyl]methyl]phenol |
|---|---|
| PubChem CID | 10573545 |
| Molecular Formula | C20H19F4N3O2 |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 5-fluoro-2-[hydroxy-[[(2R)-1-(1H-imidazol-5-yl)propan-2-yl]amino]-[4-(trifluoromethyl)phenyl]methyl]phenol |
| SMILES | C[C@H](Cc1cnc[nH]1)NC(O)(c1ccc(C(F)(F)F)cc1)c1ccc(F)cc1O |
| InChI | InChI=1S/C20H19F4N3O2/c1-12(8-16-10-25-11-26-16)27-19(29,17-7-6-15(21)9-18(17)28)13-2-4-14(5-3-13)20(22,23)24/h2-7,9-12,27-29H,8H2,1H3,(H,25,26)/t12-,19?/m1/s1 |
| InChIKey | IEVVZHXKARMYMU-ISGGMURCSA-N |
| XLogP | 3.69 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|