C24H20N2O6 — CID 10574750
5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione (PubChem CID 10574750) has the molecular formula C24H20N2O6 and a molecular weight of 432.43 g/mol. Its IUPAC name is 5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione.
| Compound Name | 5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione |
|---|---|
| PubChem CID | 10574750 |
| Molecular Formula | C24H20N2O6 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione |
| SMILES | COC1=C(C)C(=O)c2c(c(COc3ccc([N+](=O)[O-])cc3)c(C)n2-c2ccccc2)C1=O |
| InChI | InChI=1S/C24H20N2O6/c1-14-22(27)21-20(23(28)24(14)31-3)19(15(2)25(21)16-7-5-4-6-8-16)13-32-18-11-9-17(10-12-18)26(29)30/h4-12H,13H2,1-3H3 |
| InChIKey | LDNMAFCAIWBLBZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 100.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|