About 5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione
5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione (PubChem CID 10574750) has the molecular formula C24H20N2O6
and a molecular weight of 432.43 g/mol. Its IUPAC name is 5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione.
Molecular Properties
| Compound Name | 5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione |
| PubChem CID | 10574750 |
| Molecular Formula | C24H20N2O6 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione |
| SMILES | COC1=C(C)C(=O)c2c(c(COc3ccc([N+](=O)[O-])cc3)c(C)n2-c2ccccc2)C1=O |
| InChI | InChI=1S/C24H20N2O6/c1-14-22(27)21-20(23(28)24(14)31-3)19(15(2)25(21)16-7-5-4-6-8-16)13-32-18-11-9-17(10-12-18)26(29)30/h4-12H,13H2,1-3H3 |
| InChIKey | LDNMAFCAIWBLBZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 100.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione?
The IUPAC name of 5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione (CID 10574750) is 5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione.
What is the SMILES notation for 5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione?
The canonical SMILES for 5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione is COC1=C(C)C(=O)c2c(c(COc3ccc([N+](=O)[O-])cc3)c(C)n2-c2ccccc2)C1=O.
What is the InChIKey of 5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione?
The InChIKey is LDNMAFCAIWBLBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O6/c1-14-22(27)21-20(23(28)24(14)31-3)19(15(2)25(21)16-7-5-4-6-8-16)13-32-18-11-9-17(10-12-18)26(29)30/h4-12H,13H2,1-3H3.
What are the key properties of 5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione?
5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione has a molecular weight of 432.43 g/mol, XLogP of 4.57, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2,6-dimethyl-3-[(4-nitrophenoxy)methyl]-1-phenylindole-4,7-dione is sourced from PubChem (CID 10574750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).