C25H37NO4S2 — CID 10576673
4-O-ethyl 1-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-2-[bis(methylsulfanyl)methylideneamino]butanedioate (PubChem CID 10576673) has the molecular formula C25H37NO4S2 and a molecular weight of 479.71 g/mol. Its IUPAC name is 4-O-ethyl 1-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-2-[bis(methylsulfanyl)methylideneamino]butanedioate.
| Compound Name | 4-O-ethyl 1-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-2-[bis(methylsulfanyl)methylideneamino]butanedioate |
|---|---|
| PubChem CID | 10576673 |
| Molecular Formula | C25H37NO4S2 |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 4-O-ethyl 1-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-2-[bis(methylsulfanyl)methylideneamino]butanedioate |
| SMILES | CCOC(=O)C[C@H](N=C(SC)SC)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C25H37NO4S2/c1-7-29-22(27)16-20(26-24(31-5)32-6)23(28)30-21-15-17(2)13-14-19(21)25(3,4)18-11-9-8-10-12-18/h8-12,17,19-21H,7,13-16H2,1-6H3/t17-,19-,20+,21-/m1/s1 |
| InChIKey | BRWCGJZICCWPBR-AYWYSENESA-N |
| XLogP | 5.72 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|