C27H39NO4S2 — CID 100966079
1-O-ethyl 5-O-[5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (Z,4S)-2-[bis(methylsulfanyl)methylideneamino]-4-methylpent-2-enedioate (PubChem CID 100966079) has the molecular formula C27H39NO4S2 and a molecular weight of 505.75 g/mol. Its IUPAC name is 1-O-ethyl 5-O-[5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (Z,4S)-2-[bis(methylsulfanyl)methylideneamino]-4-methylpent-2-enedioate.
| Compound Name | 1-O-ethyl 5-O-[5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (Z,4S)-2-[bis(methylsulfanyl)methylideneamino]-4-methylpent-2-enedioate |
|---|---|
| PubChem CID | 100966079 |
| Molecular Formula | C27H39NO4S2 |
| Molecular Weight | 505.75 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 1-O-ethyl 5-O-[5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (Z,4S)-2-[bis(methylsulfanyl)methylideneamino]-4-methylpent-2-enedioate |
| SMILES | CCOC(=O)/C(=C/[C@H](C)C(=O)OC1CC(C)CCC1C(C)(C)c1ccccc1)N=C(SC)SC |
| InChI | InChI=1S/C27H39NO4S2/c1-8-31-25(30)22(28-26(33-6)34-7)17-19(3)24(29)32-23-16-18(2)14-15-21(23)27(4,5)20-12-10-9-11-13-20/h9-13,17-19,21,23H,8,14-16H2,1-7H3/b22-17-/t18?,19-,21?,23?/m0/s1 |
| InChIKey | WPFBLATYGRMMRY-ICZWGHNRSA-N |
| XLogP | 6.48 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.75 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|