C35H43NO2 — CID 10984028
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,4S)-4-(dibenzylamino)pent-2-enoate (PubChem CID 10984028) has the molecular formula C35H43NO2 and a molecular weight of 509.73 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,4S)-4-(dibenzylamino)pent-2-enoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,4S)-4-(dibenzylamino)pent-2-enoate |
|---|---|
| PubChem CID | 10984028 |
| Molecular Formula | C35H43NO2 |
| Molecular Weight | 509.73 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,4S)-4-(dibenzylamino)pent-2-enoate |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@H](OC(=O)/C=C/[C@H](C)N(Cc2ccccc2)Cc2ccccc2)C1 |
| InChI | InChI=1S/C35H43NO2/c1-27-20-22-32(35(3,4)31-18-12-7-13-19-31)33(24-27)38-34(37)23-21-28(2)36(25-29-14-8-5-9-15-29)26-30-16-10-6-11-17-30/h5-19,21,23,27-28,32-33H,20,22,24-26H2,1-4H3/b23-21+/t27-,28+,32-,33-/m1/s1 |
| InChIKey | KPZTVPRANHYOCQ-DGMRFJCHSA-N |
| XLogP | 7.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.73 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|